C24H26GeN2 — CID 162692812
[4-(3,5-dimethylphenyl)-2-methylbenzo[h]quinazolin-10-yl]-trimethylgermane (PubChem CID 162692812) has the molecular formula C24H26GeN2 and a molecular weight of 415.10 g/mol. Its IUPAC name is [4-(3,5-dimethylphenyl)-2-methylbenzo[h]quinazolin-10-yl]-trimethylgermane.
| Compound Name | [4-(3,5-dimethylphenyl)-2-methylbenzo[h]quinazolin-10-yl]-trimethylgermane |
|---|---|
| PubChem CID | 162692812 |
| Molecular Formula | C24H26GeN2 |
| Molecular Weight | 415.10 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | [4-(3,5-dimethylphenyl)-2-methylbenzo[h]quinazolin-10-yl]-trimethylgermane |
| SMILES | Cc1cc(C)cc(-c2nc(C)nc3c2ccc2cccc([Ge](C)(C)C)c23)c1 |
| InChI | InChI=1S/C24H26GeN2/c1-15-12-16(2)14-19(13-15)23-20-11-10-18-8-7-9-21(25(4,5)6)22(18)24(20)27-17(3)26-23/h7-14H,1-6H3 |
| InChIKey | YHFBTSIPLWZTFK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.10 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|