C19H14 — CID 123187925
8-methylpentacyclo[8.6.2.02,5.06,18.013,17]octadeca-1(16),2(5),6,8,10(18),11,13(17),14-octaene (PubChem CID 123187925) has the molecular formula C19H14 and a molecular weight of 242.32 g/mol. Its IUPAC name is 8-methylpentacyclo[8.6.2.02,5.06,18.013,17]octadeca-1(16),2(5),6,8,10(18),11,13(17),14-octaene.
| Compound Name | 8-methylpentacyclo[8.6.2.02,5.06,18.013,17]octadeca-1(16),2(5),6,8,10(18),11,13(17),14-octaene |
|---|---|
| PubChem CID | 123187925 |
| Molecular Formula | C19H14 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 8-methylpentacyclo[8.6.2.02,5.06,18.013,17]octadeca-1(16),2(5),6,8,10(18),11,13(17),14-octaene |
| SMILES | Cc1cc2ccc3cccc4c5c(c(c1)c2c34)CC5 |
| InChI | InChI=1S/C19H14/c1-11-9-13-6-5-12-3-2-4-16-14-7-8-15(14)17(10-11)19(13)18(12)16/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | JRILPWRAYGZHGN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|