C18H14 — CID 91667650
4,10-dimethylpyrene (PubChem CID 91667650) has the molecular formula C18H14 and a molecular weight of 230.31 g/mol. Its IUPAC name is 4,10-dimethylpyrene.
| Compound Name | 4,10-dimethylpyrene |
|---|---|
| PubChem CID | 91667650 |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 4,10-dimethylpyrene |
| SMILES | Cc1cc2cccc3cc(C)c4cccc1c4c23 |
| InChI | InChI=1S/C18H14/c1-11-9-13-5-3-6-14-10-12(2)16-8-4-7-15(11)18(16)17(13)14/h3-10H,1-2H3 |
| InChIKey | UWIWZSLEMPLXBZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|