About 4,10-ditert-butylpyrene
4,10-ditert-butylpyrene (PubChem CID 140674457) has the molecular formula C24H26
and a molecular weight of 314.47 g/mol. Its IUPAC name is 4,10-ditert-butylpyrene.
Molecular Properties
| Compound Name | 4,10-ditert-butylpyrene |
| PubChem CID | 140674457 |
| Molecular Formula | C24H26 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 4,10-ditert-butylpyrene |
| SMILES | CC(C)(C)c1cc2cccc3cc(C(C)(C)C)c4cccc1c4c23 |
| InChI | InChI=1S/C24H26/c1-23(2,3)19-13-15-9-7-10-16-14-20(24(4,5)6)18-12-8-11-17(19)22(18)21(15)16/h7-14H,1-6H3 |
| InChIKey | VORLULDQXXHBSQ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4,10-ditert-butylpyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,10-ditert-butylpyrene?
The IUPAC name of 4,10-ditert-butylpyrene (CID 140674457) is 4,10-ditert-butylpyrene.
What is the SMILES notation for 4,10-ditert-butylpyrene?
The canonical SMILES for 4,10-ditert-butylpyrene is CC(C)(C)c1cc2cccc3cc(C(C)(C)C)c4cccc1c4c23.
What is the InChIKey of 4,10-ditert-butylpyrene?
The InChIKey is VORLULDQXXHBSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26/c1-23(2,3)19-13-15-9-7-10-16-14-20(24(4,5)6)18-12-8-11-17(19)22(18)21(15)16/h7-14H,1-6H3.
What are the key properties of 4,10-ditert-butylpyrene?
4,10-ditert-butylpyrene has a molecular weight of 314.47 g/mol, XLogP of 7.18, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,10-ditert-butylpyrene is sourced from PubChem (CID 140674457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).