C30H34 — CID 59845242
4,9,16-tritert-butylpentacyclo[8.8.0.02,7.03,17.013,18]octadeca-1,3,5,7,9,11,13(18),14,16-nonaene (PubChem CID 59845242) has the molecular formula C30H34 and a molecular weight of 394.60 g/mol. Its IUPAC name is 4,9,16-tritert-butylpentacyclo[8.8.0.02,7.03,17.013,18]octadeca-1,3,5,7,9,11,13(18),14,16-nonaene.
| Compound Name | 4,9,16-tritert-butylpentacyclo[8.8.0.02,7.03,17.013,18]octadeca-1,3,5,7,9,11,13(18),14,16-nonaene |
|---|---|
| PubChem CID | 59845242 |
| Molecular Formula | C30H34 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 4,9,16-tritert-butylpentacyclo[8.8.0.02,7.03,17.013,18]octadeca-1,3,5,7,9,11,13(18),14,16-nonaene |
| SMILES | CC(C)(C)c1ccc2ccc3c(C(C)(C)C)cc4ccc(C(C)(C)C)c5c4c3c2c1-5 |
| InChI | InChI=1S/C30H34/c1-28(2,3)20-14-11-17-10-13-19-22(30(7,8)9)16-18-12-15-21(29(4,5)6)27-24(18)25(19)23(17)26(20)27/h10-16H,1-9H3 |
| InChIKey | YWUPJBXWNZHMKV-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|