C38H40 — CID 58273288
1,12-ditert-butyl-3,9-di(propan-2-yl)coronene (PubChem CID 58273288) has the molecular formula C38H40 and a molecular weight of 496.74 g/mol. Its IUPAC name is 1,12-ditert-butyl-3,9-di(propan-2-yl)coronene.
| Compound Name | 1,12-ditert-butyl-3,9-di(propan-2-yl)coronene |
|---|---|
| PubChem CID | 58273288 |
| Molecular Formula | C38H40 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | 1,12-ditert-butyl-3,9-di(propan-2-yl)coronene |
| SMILES | CC(C)c1cc2cc(C(C)(C)C)c3c(C(C)(C)C)cc4c(C(C)C)cc5ccc6ccc1c1c6c5c4c3c21 |
| InChI | InChI=1S/C38H40/c1-19(2)25-16-23-17-28(37(5,6)7)35-29(38(8,9)10)18-27-26(20(3)4)15-22-12-11-21-13-14-24(25)33-30(21)31(22)34(27)36(35)32(23)33/h11-20H,1-10H3 |
| InChIKey | GIYSVWQYDIIKGA-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|