C68H80 — CID 159548301
3,4-ditert-butyl-1,6-di(propan-2-yl)perylene;3,4-ditert-butyl-1,7-di(propan-2-yl)perylene (PubChem CID 159548301) has the molecular formula C68H80 and a molecular weight of 897.39 g/mol. Its IUPAC name is 3,4-ditert-butyl-1,6-di(propan-2-yl)perylene;3,4-ditert-butyl-1,7-di(propan-2-yl)perylene.
| Compound Name | 3,4-ditert-butyl-1,6-di(propan-2-yl)perylene;3,4-ditert-butyl-1,7-di(propan-2-yl)perylene |
|---|---|
| PubChem CID | 159548301 |
| Molecular Formula | C68H80 |
| Molecular Weight | 897.39 g/mol |
| Exact Mass | 896.63 |
| IUPAC Name | 3,4-ditert-butyl-1,6-di(propan-2-yl)perylene;3,4-ditert-butyl-1,7-di(propan-2-yl)perylene |
| SMILES | CC(C)c1cc(C(C)(C)C)c2c(C(C)(C)C)cc(C(C)C)c3c4cccc5cccc(c1c23)c54.CC(C)c1ccc2cccc3c4c(C(C)C)cc(C(C)(C)C)c5c(C(C)(C)C)ccc(c1c23)c54 |
| InChI | InChI=1S/2C34H40/c1-19(2)24-17-26(33(5,6)7)31-27(34(8,9)10)18-25(20(3)4)30-23-16-12-14-21-13-11-15-22(28(21)23)29(24)32(30)31;1-19(2)22-15-14-21-12-11-13-23-28(21)29(22)24-16-17-26(33(5,6)7)32-27(34(8,9)10)18-25(20(3)4)30(23)31(24)32/h2*11-20H,1-10H3 |
| InChIKey | MFBNVEYVERRXOG-UHFFFAOYSA-N |
| XLogP | 21.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.39 |
| LogP ≤ 5 | 21.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|