C44H60 — CID 58273316
1,3,4,7,9,10-hexatert-butylperylene (PubChem CID 58273316) has the molecular formula C44H60 and a molecular weight of 588.96 g/mol. Its IUPAC name is 1,3,4,7,9,10-hexatert-butylperylene.
| Compound Name | 1,3,4,7,9,10-hexatert-butylperylene |
|---|---|
| PubChem CID | 58273316 |
| Molecular Formula | C44H60 |
| Molecular Weight | 588.96 g/mol |
| Exact Mass | 588.47 |
| IUPAC Name | 1,3,4,7,9,10-hexatert-butylperylene |
| SMILES | CC(C)(C)c1ccc2c3c(C(C)(C)C)cc(C(C)(C)C)c4c(C(C)(C)C)ccc(c5c(C(C)(C)C)cc(C(C)(C)C)c1c25)c43 |
| InChI | InChI=1S/C44H60/c1-39(2,3)27-21-19-25-34-30(42(10,11)12)24-32(44(16,17)18)38-28(40(4,5)6)22-20-26(36(34)38)33-29(41(7,8)9)23-31(43(13,14)15)37(27)35(25)33/h19-24H,1-18H3 |
| InChIKey | DRSUKPOTYFSVDM-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.96 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|