C16H22S — CID 59402895
3,6-ditert-butyl-1-benzothiophene (PubChem CID 59402895) has the molecular formula C16H22S and a molecular weight of 246.42 g/mol. Its IUPAC name is 3,6-ditert-butyl-1-benzothiophene.
| Compound Name | 3,6-ditert-butyl-1-benzothiophene |
|---|---|
| PubChem CID | 59402895 |
| Molecular Formula | C16H22S |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3,6-ditert-butyl-1-benzothiophene |
| SMILES | CC(C)(C)c1ccc2c(C(C)(C)C)csc2c1 |
| InChI | InChI=1S/C16H22S/c1-15(2,3)11-7-8-12-13(16(4,5)6)10-17-14(12)9-11/h7-10H,1-6H3 |
| InChIKey | NWFZATORWLWSNB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |