C22H20S — CID 138708120
3-tert-butyl-7-phenyldibenzothiophene (PubChem CID 138708120) has the molecular formula C22H20S and a molecular weight of 316.47 g/mol. Its IUPAC name is 3-tert-butyl-7-phenyldibenzothiophene.
| Compound Name | 3-tert-butyl-7-phenyldibenzothiophene |
|---|---|
| PubChem CID | 138708120 |
| Molecular Formula | C22H20S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-tert-butyl-7-phenyldibenzothiophene |
| SMILES | CC(C)(C)c1ccc2c(c1)sc1cc(-c3ccccc3)ccc12 |
| InChI | InChI=1S/C22H20S/c1-22(2,3)17-10-12-19-18-11-9-16(15-7-5-4-6-8-15)13-20(18)23-21(19)14-17/h4-14H,1-3H3 |
| InChIKey | ZXNCFMRDLKWUOR-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |