C54H48S — CID 90262346
2-(4-tert-butylphenyl)-8-[6-(3-phenylphenyl)-9,10-di(propan-2-yl)anthracen-2-yl]dibenzothiophene (PubChem CID 90262346) has the molecular formula C54H48S and a molecular weight of 729.05 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-8-[6-(3-phenylphenyl)-9,10-di(propan-2-yl)anthracen-2-yl]dibenzothiophene.
| Compound Name | 2-(4-tert-butylphenyl)-8-[6-(3-phenylphenyl)-9,10-di(propan-2-yl)anthracen-2-yl]dibenzothiophene |
|---|---|
| PubChem CID | 90262346 |
| Molecular Formula | C54H48S |
| Molecular Weight | 729.05 g/mol |
| Exact Mass | 728.35 |
| IUPAC Name | 2-(4-tert-butylphenyl)-8-[6-(3-phenylphenyl)-9,10-di(propan-2-yl)anthracen-2-yl]dibenzothiophene |
| SMILES | CC(C)c1c2ccc(-c3ccc4sc5ccc(-c6ccc(C(C)(C)C)cc6)cc5c4c3)cc2c(C(C)C)c2ccc(-c3cccc(-c4ccccc4)c3)cc12 |
| InChI | InChI=1S/C54H48S/c1-33(2)52-45-25-19-41(42-21-27-51-47(30-42)46-29-39(20-26-50(46)55-51)36-16-22-43(23-17-36)54(5,6)7)32-49(45)53(34(3)4)44-24-18-40(31-48(44)52)38-15-11-14-37(28-38)35-12-9-8-10-13-35/h8-34H,1-7H3 |
| InChIKey | ILWWRBHMMJYIIC-UHFFFAOYSA-N |
| XLogP | 16.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.05 |
| LogP ≤ 5 | 16.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|