C58H50 — CID 59745944
2,7-bis[4-(4-tert-butylphenyl)phenyl]-9,10-diphenylanthracene (PubChem CID 59745944) has the molecular formula C58H50 and a molecular weight of 747.04 g/mol. Its IUPAC name is 2,7-bis[4-(4-tert-butylphenyl)phenyl]-9,10-diphenylanthracene.
| Compound Name | 2,7-bis[4-(4-tert-butylphenyl)phenyl]-9,10-diphenylanthracene |
|---|---|
| PubChem CID | 59745944 |
| Molecular Formula | C58H50 |
| Molecular Weight | 747.04 g/mol |
| Exact Mass | 746.39 |
| IUPAC Name | 2,7-bis[4-(4-tert-butylphenyl)phenyl]-9,10-diphenylanthracene |
| SMILES | CC(C)(C)c1ccc(-c2ccc(-c3ccc4c(-c5ccccc5)c5ccc(-c6ccc(-c7ccc(C(C)(C)C)cc7)cc6)cc5c(-c5ccccc5)c4c3)cc2)cc1 |
| InChI | InChI=1S/C58H50/c1-57(2,3)49-31-25-41(26-32-49)39-17-21-43(22-18-39)47-29-35-51-53(37-47)56(46-15-11-8-12-16-46)54-38-48(30-36-52(54)55(51)45-13-9-7-10-14-45)44-23-19-40(20-24-44)42-27-33-50(34-28-42)58(4,5)6/h7-38H,1-6H3 |
| InChIKey | AXQBUISPCUQVGZ-UHFFFAOYSA-N |
| XLogP | 16.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.04 |
| LogP ≤ 5 | 16.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|