C49H40O — CID 59002256
2-tert-butyl-6-(4-methoxyphenyl)-9,10-bis(4-phenylphenyl)anthracene (PubChem CID 59002256) has the molecular formula C49H40O and a molecular weight of 644.86 g/mol. Its IUPAC name is 2-tert-butyl-6-(4-methoxyphenyl)-9,10-bis(4-phenylphenyl)anthracene.
| Compound Name | 2-tert-butyl-6-(4-methoxyphenyl)-9,10-bis(4-phenylphenyl)anthracene |
|---|---|
| PubChem CID | 59002256 |
| Molecular Formula | C49H40O |
| Molecular Weight | 644.86 g/mol |
| Exact Mass | 644.31 |
| IUPAC Name | 2-tert-butyl-6-(4-methoxyphenyl)-9,10-bis(4-phenylphenyl)anthracene |
| SMILES | COc1ccc(-c2ccc3c(-c4ccc(-c5ccccc5)cc4)c4cc(C(C)(C)C)ccc4c(-c4ccc(-c5ccccc5)cc4)c3c2)cc1 |
| InChI | InChI=1S/C49H40O/c1-49(2,3)41-26-30-44-46(32-41)48(39-21-17-36(18-22-39)34-13-9-6-10-14-34)43-29-25-40(37-23-27-42(50-4)28-24-37)31-45(43)47(44)38-19-15-35(16-20-38)33-11-7-5-8-12-33/h5-32H,1-4H3 |
| InChIKey | NIUZOOBGJMNJQB-UHFFFAOYSA-N |
| XLogP | 13.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.86 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|