C32H30S2 — CID 166787812
1-tert-butyl-3-(8-tert-butyldibenzothiophen-3-yl)dibenzothiophene (PubChem CID 166787812) has the molecular formula C32H30S2 and a molecular weight of 478.73 g/mol. Its IUPAC name is 1-tert-butyl-3-(8-tert-butyldibenzothiophen-3-yl)dibenzothiophene.
| Compound Name | 1-tert-butyl-3-(8-tert-butyldibenzothiophen-3-yl)dibenzothiophene |
|---|---|
| PubChem CID | 166787812 |
| Molecular Formula | C32H30S2 |
| Molecular Weight | 478.73 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 1-tert-butyl-3-(8-tert-butyldibenzothiophen-3-yl)dibenzothiophene |
| SMILES | CC(C)(C)c1ccc2sc3cc(-c4cc(C(C)(C)C)c5c(c4)sc4ccccc45)ccc3c2c1 |
| InChI | InChI=1S/C32H30S2/c1-31(2,3)21-12-14-27-24(18-21)22-13-11-19(16-28(22)33-27)20-15-25(32(4,5)6)30-23-9-7-8-10-26(23)34-29(30)17-20/h7-18H,1-6H3 |
| InChIKey | GAKNUMJCLJKHLM-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.73 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |