C22H26S — CID 169050425
2-(2,6-ditert-butylnaphthalen-1-yl)thiophene (PubChem CID 169050425) has the molecular formula C22H26S and a molecular weight of 322.52 g/mol. Its IUPAC name is 2-(2,6-ditert-butylnaphthalen-1-yl)thiophene.
| Compound Name | 2-(2,6-ditert-butylnaphthalen-1-yl)thiophene |
|---|---|
| PubChem CID | 169050425 |
| Molecular Formula | C22H26S |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-(2,6-ditert-butylnaphthalen-1-yl)thiophene |
| SMILES | CC(C)(C)c1ccc2c(-c3cccs3)c(C(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C22H26S/c1-21(2,3)16-10-11-17-15(14-16)9-12-18(22(4,5)6)20(17)19-8-7-13-23-19/h7-14H,1-6H3 |
| InChIKey | KMKDZWAVWIOERM-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |