C27H28BrN — CID 131964922
2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine (PubChem CID 131964922) has the molecular formula C27H28BrN and a molecular weight of 446.43 g/mol. Its IUPAC name is 2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine.
| Compound Name | 2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine |
|---|---|
| PubChem CID | 131964922 |
| Molecular Formula | C27H28BrN |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine |
| SMILES | CC(C)(C)c1ccc2c(-c3cccc(Br)n3)c3cc(C(C)(C)C)ccc3cc2c1 |
| InChI | InChI=1S/C27H28BrN/c1-26(2,3)19-12-13-21-18(15-19)14-17-10-11-20(27(4,5)6)16-22(17)25(21)23-8-7-9-24(28)29-23/h7-16H,1-6H3 |
| InChIKey | ZLTFNLABHLBYLM-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|