About 2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine
2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine (PubChem CID 131964922) has the molecular formula C27H28BrN
and a molecular weight of 446.43 g/mol. Its IUPAC name is 2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine.
Molecular Properties
| Compound Name | 2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine |
| PubChem CID | 131964922 |
| Molecular Formula | C27H28BrN |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine |
| SMILES | CC(C)(C)c1ccc2c(-c3cccc(Br)n3)c3cc(C(C)(C)C)ccc3cc2c1 |
| InChI | InChI=1S/C27H28BrN/c1-26(2,3)19-12-13-21-18(15-19)14-17-10-11-20(27(4,5)6)16-22(17)25(21)23-8-7-9-24(28)29-23/h7-16H,1-6H3 |
| InChIKey | ZLTFNLABHLBYLM-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine?
The IUPAC name of 2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine (CID 131964922) is 2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine.
What is the SMILES notation for 2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine?
The canonical SMILES for 2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine is CC(C)(C)c1ccc2c(-c3cccc(Br)n3)c3cc(C(C)(C)C)ccc3cc2c1.
What is the InChIKey of 2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine?
The InChIKey is ZLTFNLABHLBYLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28BrN/c1-26(2,3)19-12-13-21-18(15-19)14-17-10-11-20(27(4,5)6)16-22(17)25(21)23-8-7-9-24(28)29-23/h7-16H,1-6H3.
What are the key properties of 2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine?
2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine has a molecular weight of 446.43 g/mol, XLogP of 8.41, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-(2,6-ditert-butylanthracen-9-yl)pyridine is sourced from PubChem (CID 131964922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).