C22H26O — CID 169050461
2-(2,6-ditert-butylnaphthalen-1-yl)furan (PubChem CID 169050461) has the molecular formula C22H26O and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-(2,6-ditert-butylnaphthalen-1-yl)furan.
| Compound Name | 2-(2,6-ditert-butylnaphthalen-1-yl)furan |
|---|---|
| PubChem CID | 169050461 |
| Molecular Formula | C22H26O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 2-(2,6-ditert-butylnaphthalen-1-yl)furan |
| SMILES | CC(C)(C)c1ccc2c(-c3ccco3)c(C(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C22H26O/c1-21(2,3)16-10-11-17-15(14-16)9-12-18(22(4,5)6)20(17)19-8-7-13-23-19/h7-14H,1-6H3 |
| InChIKey | NBYJISFAEWHMNS-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |