About ethane;2-(furan-2-yl)furan
ethane;2-(furan-2-yl)furan (PubChem CID 161366084) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is ethane;2-(furan-2-yl)furan.
Molecular Properties
| Compound Name | ethane;2-(furan-2-yl)furan |
| PubChem CID | 161366084 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | ethane;2-(furan-2-yl)furan |
| SMILES | CC.CC.c1coc(-c2ccco2)c1 |
| InChI | InChI=1S/C8H6O2.2C2H6/c1-3-7(9-5-1)8-4-2-6-10-8;2*1-2/h1-6H;2*1-2H3 |
| InChIKey | VPVDRTQBKMZFNN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-(furan-2-yl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(furan-2-yl)furan?
The IUPAC name of ethane;2-(furan-2-yl)furan (CID 161366084) is ethane;2-(furan-2-yl)furan.
What is the SMILES notation for ethane;2-(furan-2-yl)furan?
The canonical SMILES for ethane;2-(furan-2-yl)furan is CC.CC.c1coc(-c2ccco2)c1.
What is the InChIKey of ethane;2-(furan-2-yl)furan?
The InChIKey is VPVDRTQBKMZFNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2.2C2H6/c1-3-7(9-5-1)8-4-2-6-10-8;2*1-2/h1-6H;2*1-2H3.
What are the key properties of ethane;2-(furan-2-yl)furan?
ethane;2-(furan-2-yl)furan has a molecular weight of 194.27 g/mol, XLogP of 4.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(furan-2-yl)furan is sourced from PubChem (CID 161366084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).