C8H7NO2 — CID 14248637
5-(furan-2-yl)-2-methyl-1,3-oxazole (PubChem CID 14248637) has the molecular formula C8H7NO2 and a molecular weight of 149.15 g/mol. Its IUPAC name is 5-(furan-2-yl)-2-methyl-1,3-oxazole.
| Compound Name | 5-(furan-2-yl)-2-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 14248637 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 5-(furan-2-yl)-2-methyl-1,3-oxazole |
| SMILES | Cc1ncc(-c2ccco2)o1 |
| InChI | InChI=1S/C8H7NO2/c1-6-9-5-8(11-6)7-3-2-4-10-7/h2-5H,1H3 |
| InChIKey | LUZLRGDXANKCHE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |