C10H12N2O2 — CID 65183444
2-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylethanamine (PubChem CID 65183444) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylethanamine.
| Compound Name | 2-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 65183444 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-[5-(furan-2-yl)-1,3-oxazol-2-yl]-N-methylethanamine |
| SMILES | CNCCc1ncc(-c2ccco2)o1 |
| InChI | InChI=1S/C10H12N2O2/c1-11-5-4-10-12-7-9(14-10)8-3-2-6-13-8/h2-3,6-7,11H,4-5H2,1H3 |
| InChIKey | ZXPKZAUJTQCJCJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 51.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |