C24H35NO3 — CID 44589369
(Z)-1-[5-(furan-2-yl)-1,3-oxazol-2-yl]heptadec-8-en-1-one (PubChem CID 44589369) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is (Z)-1-[5-(furan-2-yl)-1,3-oxazol-2-yl]heptadec-8-en-1-one.
| Compound Name | (Z)-1-[5-(furan-2-yl)-1,3-oxazol-2-yl]heptadec-8-en-1-one |
|---|---|
| PubChem CID | 44589369 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | (Z)-1-[5-(furan-2-yl)-1,3-oxazol-2-yl]heptadec-8-en-1-one |
| SMILES | CCCCCCCC/C=C\CCCCCCC(=O)c1ncc(-c2ccco2)o1 |
| InChI | InChI=1S/C24H35NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-21(26)24-25-20-23(28-24)22-18-16-19-27-22/h9-10,16,18-20H,2-8,11-15,17H2,1H3/b10-9- |
| InChIKey | YBDBSZNKNZTBRB-KTKRTIGZSA-N |
| XLogP | 7.76 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|