C25H37NO2S — CID 85429246
1-(5-thiophen-3-yl-1,3-oxazol-2-yl)octadec-9-en-1-one (PubChem CID 85429246) has the molecular formula C25H37NO2S and a molecular weight of 415.64 g/mol. Its IUPAC name is 1-(5-thiophen-3-yl-1,3-oxazol-2-yl)octadec-9-en-1-one.
| Compound Name | 1-(5-thiophen-3-yl-1,3-oxazol-2-yl)octadec-9-en-1-one |
|---|---|
| PubChem CID | 85429246 |
| Molecular Formula | C25H37NO2S |
| Molecular Weight | 415.64 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 1-(5-thiophen-3-yl-1,3-oxazol-2-yl)octadec-9-en-1-one |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)c1ncc(-c2ccsc2)o1 |
| InChI | InChI=1S/C25H37NO2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(27)25-26-20-24(28-25)22-18-19-29-21-22/h9-10,18-21H,2-8,11-17H2,1H3 |
| InChIKey | XISCAYKFFZVAFV-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.64 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|