C21H36N2O — CID 54081693
1-(1H-imidazol-5-yl)octadec-9-en-1-one (PubChem CID 54081693) has the molecular formula C21H36N2O and a molecular weight of 332.53 g/mol. Its IUPAC name is 1-(1H-imidazol-5-yl)octadec-9-en-1-one.
| Compound Name | 1-(1H-imidazol-5-yl)octadec-9-en-1-one |
|---|---|
| PubChem CID | 54081693 |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | 1-(1H-imidazol-5-yl)octadec-9-en-1-one |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C21H36N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)20-18-22-19-23-20/h9-10,18-19H,2-8,11-17H2,1H3,(H,22,23) |
| InChIKey | MNOOYJKXSQWWOD-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|