About cadmium;bis((E)-octadec-9-enoic acid)
cadmium;bis((E)-octadec-9-enoic acid) (PubChem CID 156767873) has the molecular formula C36H68CdO4
and a molecular weight of 677.35 g/mol. Its IUPAC name is cadmium;bis((E)-octadec-9-enoic acid).
Molecular Properties
| Compound Name | cadmium;bis((E)-octadec-9-enoic acid) |
| PubChem CID | 156767873 |
| Molecular Formula | C36H68CdO4 |
| Molecular Weight | 677.35 g/mol |
| Exact Mass | 678.42 |
| IUPAC Name | cadmium;bis((E)-octadec-9-enoic acid) |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)O.CCCCCCCC/C=C/CCCCCCCC(=O)O.[Cd] |
| InChI | InChI=1S/2C18H34O2.Cd/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2*9-10H,2-8,11-17H2,1H3,(H,19,20);/b2*10-9+; |
| InChIKey | WNFHMNVXOOYMFL-JGMJEEPBSA-N |
| XLogP | 12.21 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 677.35 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cadmium;bis((E)-octadec-9-enoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium;bis((E)-octadec-9-enoic acid)?
The IUPAC name of cadmium;bis((E)-octadec-9-enoic acid) (CID 156767873) is cadmium;bis((E)-octadec-9-enoic acid).
What is the SMILES notation for cadmium;bis((E)-octadec-9-enoic acid)?
The canonical SMILES for cadmium;bis((E)-octadec-9-enoic acid) is CCCCCCCC/C=C/CCCCCCCC(=O)O.CCCCCCCC/C=C/CCCCCCCC(=O)O.[Cd].
What is the InChIKey of cadmium;bis((E)-octadec-9-enoic acid)?
The InChIKey is WNFHMNVXOOYMFL-JGMJEEPBSA-N. The full InChI is InChI=1S/2C18H34O2.Cd/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2*9-10H,2-8,11-17H2,1H3,(H,19,20);/b2*10-9+;.
What are the key properties of cadmium;bis((E)-octadec-9-enoic acid)?
cadmium;bis((E)-octadec-9-enoic acid) has a molecular weight of 677.35 g/mol, XLogP of 12.21, 30 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium;bis((E)-octadec-9-enoic acid) is sourced from PubChem (CID 156767873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).