C20H34N2OS — CID 68541486
(E)-1-(1,3,4-thiadiazol-2-yl)octadec-9-en-1-one (PubChem CID 68541486) has the molecular formula C20H34N2OS and a molecular weight of 350.57 g/mol. Its IUPAC name is (E)-1-(1,3,4-thiadiazol-2-yl)octadec-9-en-1-one.
| Compound Name | (E)-1-(1,3,4-thiadiazol-2-yl)octadec-9-en-1-one |
|---|---|
| PubChem CID | 68541486 |
| Molecular Formula | C20H34N2OS |
| Molecular Weight | 350.57 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (E)-1-(1,3,4-thiadiazol-2-yl)octadec-9-en-1-one |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)c1nncs1 |
| InChI | InChI=1S/C20H34N2OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(23)20-22-21-18-24-20/h9-10,18H,2-8,11-17H2,1H3/b10-9+ |
| InChIKey | OGPJTMSGDUTXCW-MDZDMXLPSA-N |
| XLogP | 6.76 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.57 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|