C24H38O3 — CID 10948772
(Z)-1-(2,6-dihydroxyphenyl)octadec-8-en-1-one (PubChem CID 10948772) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is (Z)-1-(2,6-dihydroxyphenyl)octadec-8-en-1-one.
| Compound Name | (Z)-1-(2,6-dihydroxyphenyl)octadec-8-en-1-one |
|---|---|
| PubChem CID | 10948772 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | (Z)-1-(2,6-dihydroxyphenyl)octadec-8-en-1-one |
| SMILES | CCCCCCCCC/C=C\CCCCCCC(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C24H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-21(25)24-22(26)19-17-20-23(24)27/h10-11,17,19-20,26-27H,2-9,12-16,18H2,1H3/b11-10- |
| InChIKey | WBXXVNCMCIJAIX-KHPPLWFESA-N |
| XLogP | 7.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|