C15H22O5S — CID 140985001
3-hydroxy-2-nonanoylbenzenesulfonic acid (PubChem CID 140985001) has the molecular formula C15H22O5S and a molecular weight of 314.40 g/mol. Its IUPAC name is 3-hydroxy-2-nonanoylbenzenesulfonic acid.
| Compound Name | 3-hydroxy-2-nonanoylbenzenesulfonic acid |
|---|---|
| PubChem CID | 140985001 |
| Molecular Formula | C15H22O5S |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-hydroxy-2-nonanoylbenzenesulfonic acid |
| SMILES | CCCCCCCCC(=O)c1c(O)cccc1S(=O)(=O)O |
| InChI | InChI=1S/C15H22O5S/c1-2-3-4-5-6-7-9-12(16)15-13(17)10-8-11-14(15)21(18,19)20/h8,10-11,17H,2-7,9H2,1H3,(H,18,19,20) |
| InChIKey | KCTCKELQPVAZNQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|