C26H38N2O2 — CID 68547196
1-(4-pyridin-3-yl-1,3-oxazol-2-yl)octadec-9-en-1-one (PubChem CID 68547196) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is 1-(4-pyridin-3-yl-1,3-oxazol-2-yl)octadec-9-en-1-one.
| Compound Name | 1-(4-pyridin-3-yl-1,3-oxazol-2-yl)octadec-9-en-1-one |
|---|---|
| PubChem CID | 68547196 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | 1-(4-pyridin-3-yl-1,3-oxazol-2-yl)octadec-9-en-1-one |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)c1nc(-c2cccnc2)co1 |
| InChI | InChI=1S/C26H38N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-25(29)26-28-24(22-30-26)23-18-17-20-27-21-23/h9-10,17-18,20-22H,2-8,11-16,19H2,1H3 |
| InChIKey | JIVKXULXTMWQMJ-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|