C18H14N2O2 — CID 5125983
2,3-bis(furan-2-yl)-6,7-dimethylquinoxaline (PubChem CID 5125983) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2,3-bis(furan-2-yl)-6,7-dimethylquinoxaline.
| Compound Name | 2,3-bis(furan-2-yl)-6,7-dimethylquinoxaline |
|---|---|
| PubChem CID | 5125983 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2,3-bis(furan-2-yl)-6,7-dimethylquinoxaline |
| SMILES | Cc1cc2nc(-c3ccco3)c(-c3ccco3)nc2cc1C |
| InChI | InChI=1S/C18H14N2O2/c1-11-9-13-14(10-12(11)2)20-18(16-6-4-8-22-16)17(19-13)15-5-3-7-21-15/h3-10H,1-2H3 |
| InChIKey | ONPYSVJIWCTZEV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |