C17H8N2O3S2 — CID 102200324
6,7-bis(furan-2-yl)-[1,3]dithiolo[4,5-g]quinoxalin-2-one (PubChem CID 102200324) has the molecular formula C17H8N2O3S2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 6,7-bis(furan-2-yl)-[1,3]dithiolo[4,5-g]quinoxalin-2-one.
| Compound Name | 6,7-bis(furan-2-yl)-[1,3]dithiolo[4,5-g]quinoxalin-2-one |
|---|---|
| PubChem CID | 102200324 |
| Molecular Formula | C17H8N2O3S2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 6,7-bis(furan-2-yl)-[1,3]dithiolo[4,5-g]quinoxalin-2-one |
| SMILES | O=c1sc2cc3nc(-c4ccco4)c(-c4ccco4)nc3cc2s1 |
| InChI | InChI=1S/C17H8N2O3S2/c20-17-23-13-7-9-10(8-14(13)24-17)19-16(12-4-2-6-22-12)15(18-9)11-3-1-5-21-11/h1-8H |
| InChIKey | VDWGVJKRTZFTDZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |