C15H7NO3S — CID 10446437
2-(furan-2-yl)benzo[f][1,3]benzothiazole-4,9-dione (PubChem CID 10446437) has the molecular formula C15H7NO3S and a molecular weight of 281.29 g/mol. Its IUPAC name is 2-(furan-2-yl)benzo[f][1,3]benzothiazole-4,9-dione.
| Compound Name | 2-(furan-2-yl)benzo[f][1,3]benzothiazole-4,9-dione |
|---|---|
| PubChem CID | 10446437 |
| Molecular Formula | C15H7NO3S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 2-(furan-2-yl)benzo[f][1,3]benzothiazole-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)c2sc(-c3ccco3)nc21 |
| InChI | InChI=1S/C15H7NO3S/c17-12-8-4-1-2-5-9(8)13(18)14-11(12)16-15(20-14)10-6-3-7-19-10/h1-7H |
| InChIKey | VJKZUTFFMNSTTD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|