C12H5NO4S — CID 11010697
4,9-dioxobenzo[f][1,3]benzothiazole-2-carboxylic acid (PubChem CID 11010697) has the molecular formula C12H5NO4S and a molecular weight of 259.24 g/mol. Its IUPAC name is 4,9-dioxobenzo[f][1,3]benzothiazole-2-carboxylic acid.
| Compound Name | 4,9-dioxobenzo[f][1,3]benzothiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 11010697 |
| Molecular Formula | C12H5NO4S |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | 4,9-dioxobenzo[f][1,3]benzothiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc2c(s1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C12H5NO4S/c14-8-5-3-1-2-4-6(5)9(15)10-7(8)13-11(18-10)12(16)17/h1-4H,(H,16,17) |
| InChIKey | LGXLYWWWVDMAJL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|