5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid

C9H7NO3S — CID 82126671

IUPAC5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid
SMILESCc1nc(C(=O)O)sc1-c1ccco1
InChIInChI=1S/C9H7NO3S/c1-5-7(6-3-2-4-13-6)14-8(10-5)9(11)12/h2-4H,1H3,(H,11,12)
InChIKeyYFLNRMQVMYVQIF-UHFFFAOYSA-N
MW209.23 g/mol
LogP2.41
Rot. Bonds2

About 5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid

5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid (PubChem CID 82126671) has the molecular formula C9H7NO3S and a molecular weight of 209.23 g/mol. Its IUPAC name is 5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid.

Molecular Properties

Compound Name5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid
PubChem CID82126671
Molecular FormulaC9H7NO3S
Molecular Weight209.23 g/mol
Exact Mass209.01
IUPAC Name5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid
SMILESCc1nc(C(=O)O)sc1-c1ccco1
InChIInChI=1S/C9H7NO3S/c1-5-7(6-3-2-4-13-6)14-8(10-5)9(11)12/h2-4H,1H3,(H,11,12)
InChIKeyYFLNRMQVMYVQIF-UHFFFAOYSA-N
XLogP2.41
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.23
LogP ≤ 52.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid (CID 82126671) is 5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid is Cc1nc(C(=O)O)sc1-c1ccco1.
What is the InChIKey of 5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid?
The InChIKey is YFLNRMQVMYVQIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3S/c1-5-7(6-3-2-4-13-6)14-8(10-5)9(11)12/h2-4H,1H3,(H,11,12).
What are the key properties of 5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid?
5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid has a molecular weight of 209.23 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-2-yl)-4-methyl-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 82126671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).