C11H7NO5 — CID 138673812
4-(furan-2-yl)pyridine-2,6-dicarboxylic acid (PubChem CID 138673812) has the molecular formula C11H7NO5 and a molecular weight of 233.18 g/mol. Its IUPAC name is 4-(furan-2-yl)pyridine-2,6-dicarboxylic acid.
| Compound Name | 4-(furan-2-yl)pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 138673812 |
| Molecular Formula | C11H7NO5 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 4-(furan-2-yl)pyridine-2,6-dicarboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccco2)cc(C(=O)O)n1 |
| InChI | InChI=1S/C11H7NO5/c13-10(14)7-4-6(9-2-1-3-17-9)5-8(12-7)11(15)16/h1-5H,(H,13,14)(H,15,16) |
| InChIKey | IVWSZPMMWIPPIB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |