C24H18N2O3 — CID 168527471
5-(furan-2-yl)-1-N,3-N-diphenylbenzene-1,3-dicarboxamide (PubChem CID 168527471) has the molecular formula C24H18N2O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 5-(furan-2-yl)-1-N,3-N-diphenylbenzene-1,3-dicarboxamide.
| Compound Name | 5-(furan-2-yl)-1-N,3-N-diphenylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 168527471 |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 5-(furan-2-yl)-1-N,3-N-diphenylbenzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)c1cc(C(=O)Nc2ccccc2)cc(-c2ccco2)c1 |
| InChI | InChI=1S/C24H18N2O3/c27-23(25-20-8-3-1-4-9-20)18-14-17(22-12-7-13-29-22)15-19(16-18)24(28)26-21-10-5-2-6-11-21/h1-16H,(H,25,27)(H,26,28) |
| InChIKey | FZVNPLJQPSGLSI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |