C24H18NO2+ — CID 2751530
N,2,6-triphenylpyrylium-4-carboxamide (PubChem CID 2751530) has the molecular formula C24H18NO2+ and a molecular weight of 352.41 g/mol. Its IUPAC name is N,2,6-triphenylpyrylium-4-carboxamide.
| Compound Name | N,2,6-triphenylpyrylium-4-carboxamide |
|---|---|
| PubChem CID | 2751530 |
| Molecular Formula | C24H18NO2+ |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N,2,6-triphenylpyrylium-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cc(-c2ccccc2)[o+]c(-c2ccccc2)c1 |
| InChI | InChI=1S/C24H17NO2/c26-24(25-21-14-8-3-9-15-21)20-16-22(18-10-4-1-5-11-18)27-23(17-20)19-12-6-2-7-13-19/h1-17H/p+1 |
| InChIKey | IINXKSAHBQRAPC-UHFFFAOYSA-O |
| XLogP | 6.15 |
| TPSA | 40.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|