C20H26ClNO6 — CID 2751521
2,6-ditert-butyl-N-phenylpyrylium-4-carboxamide perchlorate (PubChem CID 2751521) has the molecular formula C20H26ClNO6 and a molecular weight of 411.88 g/mol. Its IUPAC name is 2,6-ditert-butyl-N-phenylpyrylium-4-carboxamide perchlorate.
| Compound Name | 2,6-ditert-butyl-N-phenylpyrylium-4-carboxamide perchlorate |
|---|---|
| PubChem CID | 2751521 |
| Molecular Formula | C20H26ClNO6 |
| Molecular Weight | 411.88 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2,6-ditert-butyl-N-phenylpyrylium-4-carboxamide perchlorate |
| SMILES | CC(C)(C)c1cc(C(=O)Nc2ccccc2)cc(C(C)(C)C)[o+]1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C20H25NO2.ClHO4/c1-19(2,3)16-12-14(13-17(23-16)20(4,5)6)18(22)21-15-10-8-7-9-11-15;2-1(3,4)5/h7-13H,1-6H3;(H,2,3,4,5) |
| InChIKey | GMVIZHAHPIZDJW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.88 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|