C21H15N3O3 — CID 169354728
5-isocyanato-1-N,3-N-diphenylbenzene-1,3-dicarboxamide (PubChem CID 169354728) has the molecular formula C21H15N3O3 and a molecular weight of 357.37 g/mol. Its IUPAC name is 5-isocyanato-1-N,3-N-diphenylbenzene-1,3-dicarboxamide.
| Compound Name | 5-isocyanato-1-N,3-N-diphenylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 169354728 |
| Molecular Formula | C21H15N3O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 5-isocyanato-1-N,3-N-diphenylbenzene-1,3-dicarboxamide |
| SMILES | O=C=Nc1cc(C(=O)Nc2ccccc2)cc(C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C21H15N3O3/c25-14-22-19-12-15(20(26)23-17-7-3-1-4-8-17)11-16(13-19)21(27)24-18-9-5-2-6-10-18/h1-13H,(H,23,26)(H,24,27) |
| InChIKey | GRKYRVMOOSXWMQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|