C11H11NO3S — CID 62633596
ethyl 4-(furan-2-yl)-5-methyl-1,3-thiazole-2-carboxylate (PubChem CID 62633596) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is ethyl 4-(furan-2-yl)-5-methyl-1,3-thiazole-2-carboxylate.
| Compound Name | ethyl 4-(furan-2-yl)-5-methyl-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 62633596 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | ethyl 4-(furan-2-yl)-5-methyl-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccco2)c(C)s1 |
| InChI | InChI=1S/C11H11NO3S/c1-3-14-11(13)10-12-9(7(2)16-10)8-5-4-6-15-8/h4-6H,3H2,1-2H3 |
| InChIKey | XTCBCYBVOHZLGB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |