About ethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate
ethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate (PubChem CID 15691762) has the molecular formula C7H9NO3S
and a molecular weight of 187.22 g/mol. Its IUPAC name is ethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate.
Analyze ethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate?
The IUPAC name of ethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate (CID 15691762) is ethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate.
What is the SMILES notation for ethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate?
The canonical SMILES for ethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate is CCOC(=O)c1nc(O)c(C)s1.
What is the InChIKey of ethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate?
The InChIKey is XGTYLIJXUZQDJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3S/c1-3-11-7(10)6-8-5(9)4(2)12-6/h9H,3H2,1-2H3.
What are the key properties of ethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate?
ethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate has a molecular weight of 187.22 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-hydroxy-5-methyl-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 15691762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).