C8H12N2O2S — CID 59459549
ethyl 5-propan-2-yl-1,3,4-thiadiazole-2-carboxylate (PubChem CID 59459549) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is ethyl 5-propan-2-yl-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | ethyl 5-propan-2-yl-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 59459549 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | ethyl 5-propan-2-yl-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nnc(C(C)C)s1 |
| InChI | InChI=1S/C8H12N2O2S/c1-4-12-8(11)7-10-9-6(13-7)5(2)3/h5H,4H2,1-3H3 |
| InChIKey | ZTTMTGYJLPUEIX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |