C10H16N2O5S — CID 113426788
ethyl 5-[2-(2-methoxyethoxy)ethoxy]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 113426788) has the molecular formula C10H16N2O5S and a molecular weight of 276.31 g/mol. Its IUPAC name is ethyl 5-[2-(2-methoxyethoxy)ethoxy]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | ethyl 5-[2-(2-methoxyethoxy)ethoxy]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 113426788 |
| Molecular Formula | C10H16N2O5S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | ethyl 5-[2-(2-methoxyethoxy)ethoxy]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nnc(OCCOCCOC)s1 |
| InChI | InChI=1S/C10H16N2O5S/c1-3-16-9(13)8-11-12-10(18-8)17-7-6-15-5-4-14-2/h3-7H2,1-2H3 |
| InChIKey | HANLKAVFDPNXTQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|