C11H9FN2O3S — CID 80612155
ethyl 5-(3-fluorophenoxy)-1,3,4-thiadiazole-2-carboxylate (PubChem CID 80612155) has the molecular formula C11H9FN2O3S and a molecular weight of 268.27 g/mol. Its IUPAC name is ethyl 5-(3-fluorophenoxy)-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | ethyl 5-(3-fluorophenoxy)-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 80612155 |
| Molecular Formula | C11H9FN2O3S |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | ethyl 5-(3-fluorophenoxy)-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nnc(Oc2cccc(F)c2)s1 |
| InChI | InChI=1S/C11H9FN2O3S/c1-2-16-10(15)9-13-14-11(18-9)17-8-5-3-4-7(12)6-8/h3-6H,2H2,1H3 |
| InChIKey | GMHGJZXHSQLWHF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |