C12H14FN3OS — CID 80619929
N-[[5-(3-fluorophenoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-1-amine (PubChem CID 80619929) has the molecular formula C12H14FN3OS and a molecular weight of 267.33 g/mol. Its IUPAC name is N-[[5-(3-fluorophenoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(3-fluorophenoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 80619929 |
| Molecular Formula | C12H14FN3OS |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | N-[[5-(3-fluorophenoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1nnc(Oc2cccc(F)c2)s1 |
| InChI | InChI=1S/C12H14FN3OS/c1-2-6-14-8-11-15-16-12(18-11)17-10-5-3-4-9(13)7-10/h3-5,7,14H,2,6,8H2,1H3 |
| InChIKey | VXCJHKDEUQIGFR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|