C12H12BrF2N3OS — CID 107101181
N-[[5-(5-bromo-2,3-difluorophenoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-1-amine (PubChem CID 107101181) has the molecular formula C12H12BrF2N3OS and a molecular weight of 364.22 g/mol. Its IUPAC name is N-[[5-(5-bromo-2,3-difluorophenoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(5-bromo-2,3-difluorophenoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107101181 |
| Molecular Formula | C12H12BrF2N3OS |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | N-[[5-(5-bromo-2,3-difluorophenoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1nnc(Oc2cc(Br)cc(F)c2F)s1 |
| InChI | InChI=1S/C12H12BrF2N3OS/c1-2-3-16-6-10-17-18-12(20-10)19-9-5-7(13)4-8(14)11(9)15/h4-5,16H,2-3,6H2,1H3 |
| InChIKey | PSGYITZYTFGWHP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|