C12H23N3OS — CID 80624767
N-[(5-hexoxy-1,3,4-thiadiazol-2-yl)methyl]propan-1-amine (PubChem CID 80624767) has the molecular formula C12H23N3OS and a molecular weight of 257.40 g/mol. Its IUPAC name is N-[(5-hexoxy-1,3,4-thiadiazol-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(5-hexoxy-1,3,4-thiadiazol-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 80624767 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-[(5-hexoxy-1,3,4-thiadiazol-2-yl)methyl]propan-1-amine |
| SMILES | CCCCCCOc1nnc(CNCCC)s1 |
| InChI | InChI=1S/C12H23N3OS/c1-3-5-6-7-9-16-12-15-14-11(17-12)10-13-8-4-2/h13H,3-10H2,1-2H3 |
| InChIKey | LWKPLUPYKSTWIX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|