C12H18N4OS2 — CID 80624096
N-[[5-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-1,3,4-thiadiazol-2-yl]methyl]propan-1-amine (PubChem CID 80624096) has the molecular formula C12H18N4OS2 and a molecular weight of 298.44 g/mol. Its IUPAC name is N-[[5-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-1,3,4-thiadiazol-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-1,3,4-thiadiazol-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 80624096 |
| Molecular Formula | C12H18N4OS2 |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | N-[[5-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-1,3,4-thiadiazol-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1nnc(OCCc2scnc2C)s1 |
| InChI | InChI=1S/C12H18N4OS2/c1-3-5-13-7-11-15-16-12(19-11)17-6-4-10-9(2)14-8-18-10/h8,13H,3-7H2,1-2H3 |
| InChIKey | XPUIHAFFCDGQRH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|