C10H19N3OS — CID 80623305
N-[(5-pentoxy-1,3,4-thiadiazol-2-yl)methyl]ethanamine (PubChem CID 80623305) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is N-[(5-pentoxy-1,3,4-thiadiazol-2-yl)methyl]ethanamine.
| Compound Name | N-[(5-pentoxy-1,3,4-thiadiazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 80623305 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | N-[(5-pentoxy-1,3,4-thiadiazol-2-yl)methyl]ethanamine |
| SMILES | CCCCCOc1nnc(CNCC)s1 |
| InChI | InChI=1S/C10H19N3OS/c1-3-5-6-7-14-10-13-12-9(15-10)8-11-4-2/h11H,3-8H2,1-2H3 |
| InChIKey | IMQUDUHLHNMQFJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|