C11H21N3OS — CID 80623732
1-(5-heptoxy-1,3,4-thiadiazol-2-yl)-N-methylmethanamine (PubChem CID 80623732) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is 1-(5-heptoxy-1,3,4-thiadiazol-2-yl)-N-methylmethanamine.
| Compound Name | 1-(5-heptoxy-1,3,4-thiadiazol-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 80623732 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-(5-heptoxy-1,3,4-thiadiazol-2-yl)-N-methylmethanamine |
| SMILES | CCCCCCCOc1nnc(CNC)s1 |
| InChI | InChI=1S/C11H21N3OS/c1-3-4-5-6-7-8-15-11-14-13-10(16-11)9-12-2/h12H,3-9H2,1-2H3 |
| InChIKey | UGVBNPDAQJJPTK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|