C9H13NO2S2 — CID 82368639
ethyl 2-propan-2-yl-5-sulfanyl-1,3-thiazole-4-carboxylate (PubChem CID 82368639) has the molecular formula C9H13NO2S2 and a molecular weight of 231.34 g/mol. Its IUPAC name is ethyl 2-propan-2-yl-5-sulfanyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-propan-2-yl-5-sulfanyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 82368639 |
| Molecular Formula | C9H13NO2S2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | ethyl 2-propan-2-yl-5-sulfanyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(C(C)C)sc1S |
| InChI | InChI=1S/C9H13NO2S2/c1-4-12-8(11)6-9(13)14-7(10-6)5(2)3/h5,13H,4H2,1-3H3 |
| InChIKey | QEDDCAUFQOMHPM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 39.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|